About 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine
3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine (PubChem CID 170715161) has the molecular formula C19H21N7
and a molecular weight of 347.43 g/mol. Its IUPAC name is 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine.
Molecular Properties
| Compound Name | 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine |
| PubChem CID | 170715161 |
| Molecular Formula | C19H21N7 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine |
| SMILES | CNc1cccc2c(-c3nc(Nc4cc(C)n(C)n4)ncc3C)c[nH]c12 |
| InChI | InChI=1S/C19H21N7/c1-11-9-22-19(23-16-8-12(2)26(4)25-16)24-17(11)14-10-21-18-13(14)6-5-7-15(18)20-3/h5-10,20-21H,1-4H3,(H,22,23,24,25) |
| InChIKey | JRETZEFPECFNCC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine?
The IUPAC name of 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine (CID 170715161) is 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine.
What is the SMILES notation for 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine?
The canonical SMILES for 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine is CNc1cccc2c(-c3nc(Nc4cc(C)n(C)n4)ncc3C)c[nH]c12.
What is the InChIKey of 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine?
The InChIKey is JRETZEFPECFNCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N7/c1-11-9-22-19(23-16-8-12(2)26(4)25-16)24-17(11)14-10-21-18-13(14)6-5-7-15(18)20-3/h5-10,20-21H,1-4H3,(H,22,23,24,25).
What are the key properties of 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine?
3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine has a molecular weight of 347.43 g/mol, XLogP of 3.76, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1,5-dimethylpyrazol-3-yl)amino]-5-methylpyrimidin-4-yl]-N-methyl-1H-indol-7-amine is sourced from PubChem (CID 170715161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).