C20H18ClFN4O2 — CID 170715516
N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-2-fluorophenyl]acetamide (PubChem CID 170715516) has the molecular formula C20H18ClFN4O2 and a molecular weight of 400.84 g/mol. Its IUPAC name is N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-2-fluorophenyl]acetamide.
| Compound Name | N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 170715516 |
| Molecular Formula | C20H18ClFN4O2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(5-chloro-4-methoxy-2-pyridinyl)-2-[4-(1-cyano-3,6-dihydro-2H-pyridin-5-yl)-2-fluorophenyl]acetamide |
| SMILES | COc1cc(NC(=O)Cc2ccc(C3=CCCN(C#N)C3)cc2F)ncc1Cl |
| InChI | InChI=1S/C20H18ClFN4O2/c1-28-18-9-19(24-10-16(18)21)25-20(27)8-14-5-4-13(7-17(14)22)15-3-2-6-26(11-15)12-23/h3-5,7,9-10H,2,6,8,11H2,1H3,(H,24,25,27) |
| InChIKey | LIVJOFOTZFBVGQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|