C22H26ClN5O3S — CID 170715533
N-[5-chloro-4-[(3-methyl-1,3-oxathiolan-3-yl)oxy]-2-pyridinyl]-2-[6-(1-cyanopiperidin-3-yl)-3-pyridinyl]acetamide (PubChem CID 170715533) has the molecular formula C22H26ClN5O3S and a molecular weight of 476.00 g/mol. Its IUPAC name is N-[5-chloro-4-[(3-methyl-1,3-oxathiolan-3-yl)oxy]-2-pyridinyl]-2-[6-(1-cyanopiperidin-3-yl)-3-pyridinyl]acetamide.
| Compound Name | N-[5-chloro-4-[(3-methyl-1,3-oxathiolan-3-yl)oxy]-2-pyridinyl]-2-[6-(1-cyanopiperidin-3-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 170715533 |
| Molecular Formula | C22H26ClN5O3S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | N-[5-chloro-4-[(3-methyl-1,3-oxathiolan-3-yl)oxy]-2-pyridinyl]-2-[6-(1-cyanopiperidin-3-yl)-3-pyridinyl]acetamide |
| SMILES | CS1(Oc2cc(NC(=O)Cc3ccc(C4CCCN(C#N)C4)nc3)ncc2Cl)CCOC1 |
| InChI | InChI=1S/C22H26ClN5O3S/c1-32(8-7-30-15-32)31-20-10-21(26-12-18(20)23)27-22(29)9-16-4-5-19(25-11-16)17-3-2-6-28(13-17)14-24/h4-5,10-12,17H,2-3,6-9,13,15H2,1H3,(H,26,27,29) |
| InChIKey | GVSRZOFRHTUIMH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|