About 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid
2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid (PubChem CID 170715983) has the molecular formula C23H22N2O4
and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid |
| PubChem CID | 170715983 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)c1nc(-c2ccccc2)c(-c2ccccc2)o1)C1CCCC1 |
| InChI | InChI=1S/C23H22N2O4/c26-19(27)15-25(18-13-7-8-14-18)23(28)22-24-20(16-9-3-1-4-10-16)21(29-22)17-11-5-2-6-12-17/h1-6,9-12,18H,7-8,13-15H2,(H,26,27) |
| InChIKey | JBPXGOLUQITVKI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid?
The IUPAC name of 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid (CID 170715983) is 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid is O=C(O)CN(C(=O)c1nc(-c2ccccc2)c(-c2ccccc2)o1)C1CCCC1.
What is the InChIKey of 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid?
The InChIKey is JBPXGOLUQITVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O4/c26-19(27)15-25(18-13-7-8-14-18)23(28)22-24-20(16-9-3-1-4-10-16)21(29-22)17-11-5-2-6-12-17/h1-6,9-12,18H,7-8,13-15H2,(H,26,27).
What are the key properties of 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid?
2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid has a molecular weight of 390.44 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopentyl-(4,5-diphenyl-1,3-oxazole-2-carbonyl)amino]acetic acid is sourced from PubChem (CID 170715983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).