About 2-hydroxytridecyl acetate
2-hydroxytridecyl acetate (PubChem CID 170716401) has the molecular formula C15H30O3
and a molecular weight of 258.40 g/mol. Its IUPAC name is 2-hydroxytridecyl acetate.
Molecular Properties
| Compound Name | 2-hydroxytridecyl acetate |
| PubChem CID | 170716401 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 2-hydroxytridecyl acetate |
| SMILES | CCCCCCCCCCCC(O)COC(C)=O |
| InChI | InChI=1S/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-15(17)13-18-14(2)16/h15,17H,3-13H2,1-2H3 |
| InChIKey | PLIRKCFMCZUDTF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxytridecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxytridecyl acetate?
The IUPAC name of 2-hydroxytridecyl acetate (CID 170716401) is 2-hydroxytridecyl acetate.
What is the SMILES notation for 2-hydroxytridecyl acetate?
The canonical SMILES for 2-hydroxytridecyl acetate is CCCCCCCCCCCC(O)COC(C)=O.
What is the InChIKey of 2-hydroxytridecyl acetate?
The InChIKey is PLIRKCFMCZUDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-15(17)13-18-14(2)16/h15,17H,3-13H2,1-2H3.
What are the key properties of 2-hydroxytridecyl acetate?
2-hydroxytridecyl acetate has a molecular weight of 258.40 g/mol, XLogP of 3.83, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxytridecyl acetate is sourced from PubChem (CID 170716401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).