C10H18N4S2 — CID 170716414
6-(heptylamino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 170716414) has the molecular formula C10H18N4S2 and a molecular weight of 258.42 g/mol. Its IUPAC name is 6-(heptylamino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(heptylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 170716414 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 6-(heptylamino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | CCCCCCCNc1nc(=S)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C10H18N4S2/c1-2-3-4-5-6-7-11-8-12-9(15)14-10(16)13-8/h2-7H2,1H3,(H3,11,12,13,14,15,16) |
| InChIKey | ATYAUIBKGALKCX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|