C15H15F4N3O — CID 170716436
2-[3-(aminomethyl)-2-fluoro-6-(trifluoromethyl)phenyl]-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 170716436) has the molecular formula C15H15F4N3O and a molecular weight of 329.30 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-2-fluoro-6-(trifluoromethyl)phenyl]-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[3-(aminomethyl)-2-fluoro-6-(trifluoromethyl)phenyl]-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170716436 |
| Molecular Formula | C15H15F4N3O |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[3-(aminomethyl)-2-fluoro-6-(trifluoromethyl)phenyl]-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1cc(=O)[nH]c(-c2c(C(F)(F)F)ccc(CN)c2F)n1 |
| InChI | InChI=1S/C15H15F4N3O/c1-7(2)10-5-11(23)22-14(21-10)12-9(15(17,18)19)4-3-8(6-20)13(12)16/h3-5,7H,6,20H2,1-2H3,(H,21,22,23) |
| InChIKey | JEMLZXVTSGAVNL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |