C50H31N3O3 — CID 170716713
N,N-bis[4-(2-phenyl-1,3-benzoxazol-6-yl)phenyl]dibenzofuran-3-amine (PubChem CID 170716713) has the molecular formula C50H31N3O3 and a molecular weight of 721.82 g/mol. Its IUPAC name is N,N-bis[4-(2-phenyl-1,3-benzoxazol-6-yl)phenyl]dibenzofuran-3-amine.
| Compound Name | N,N-bis[4-(2-phenyl-1,3-benzoxazol-6-yl)phenyl]dibenzofuran-3-amine |
|---|---|
| PubChem CID | 170716713 |
| Molecular Formula | C50H31N3O3 |
| Molecular Weight | 721.82 g/mol |
| Exact Mass | 721.24 |
| IUPAC Name | N,N-bis[4-(2-phenyl-1,3-benzoxazol-6-yl)phenyl]dibenzofuran-3-amine |
| SMILES | c1ccc(-c2nc3ccc(-c4ccc(N(c5ccc(-c6ccc7nc(-c8ccccc8)oc7c6)cc5)c5ccc6c(c5)oc5ccccc56)cc4)cc3o2)cc1 |
| InChI | InChI=1S/C50H31N3O3/c1-3-9-34(10-4-1)49-51-43-27-19-36(29-47(43)55-49)32-15-21-38(22-16-32)53(40-25-26-42-41-13-7-8-14-45(41)54-46(42)31-40)39-23-17-33(18-24-39)37-20-28-44-48(30-37)56-50(52-44)35-11-5-2-6-12-35/h1-31H |
| InChIKey | AFCOXVMRRHEQIO-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 68.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.82 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |