C22H30N2O2S — CID 170717195
ethane;2-[(3E)-penta-1,3-dien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid;prop-1-ene (PubChem CID 170717195) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is ethane;2-[(3E)-penta-1,3-dien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid;prop-1-ene.
| Compound Name | ethane;2-[(3E)-penta-1,3-dien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 170717195 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethane;2-[(3E)-penta-1,3-dien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid;prop-1-ene |
| SMILES | C=C/C(=C\C)c1cn2c(n1)sc1cc(C(=O)O)ccc12.C=CC.CC.CC |
| InChI | InChI=1S/C15H12N2O2S.C3H6.2C2H6/c1-3-9(4-2)11-8-17-12-6-5-10(14(18)19)7-13(12)20-15(17)16-11;1-3-2;2*1-2/h3-8H,1H2,2H3,(H,18,19);3H,1H2,2H3;2*1-2H3/b9-4+;;; |
| InChIKey | CONMOXGWFIVMEV-UNVQDCCZSA-N |
| XLogP | 7.08 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|