C28H31F4N5OS — CID 170717624
[2-[4-(4,4-difluoropyrrolidin-2-yl)-2-fluorophenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol (PubChem CID 170717624) has the molecular formula C28H31F4N5OS and a molecular weight of 561.65 g/mol. Its IUPAC name is [2-[4-(4,4-difluoropyrrolidin-2-yl)-2-fluorophenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol.
| Compound Name | [2-[4-(4,4-difluoropyrrolidin-2-yl)-2-fluorophenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol |
|---|---|
| PubChem CID | 170717624 |
| Molecular Formula | C28H31F4N5OS |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | [2-[4-(4,4-difluoropyrrolidin-2-yl)-2-fluorophenyl]imidazo[2,1-b][1,3]benzothiazol-6-yl]-[3-(4-fluoropiperidin-1-yl)propylamino]methanol |
| SMILES | OC(NCCCN1CCC(F)CC1)c1ccc2c(c1)sc1nc(-c3ccc(C4CC(F)(F)CN4)cc3F)cn12 |
| InChI | InChI=1S/C28H31F4N5OS/c29-19-6-10-36(11-7-19)9-1-8-33-26(38)18-3-5-24-25(13-18)39-27-35-23(15-37(24)27)20-4-2-17(12-21(20)30)22-14-28(31,32)16-34-22/h2-5,12-13,15,19,22,26,33-34,38H,1,6-11,14,16H2 |
| InChIKey | GNJCMYSAFIOVEB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|