C16H13N3O2S — CID 170717707
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1,2,4]triazolo[5,1-b][1,3]benzothiazole-6-carboxylic acid (PubChem CID 170717707) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1,2,4]triazolo[5,1-b][1,3]benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1,2,4]triazolo[5,1-b][1,3]benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 170717707 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1,2,4]triazolo[5,1-b][1,3]benzothiazole-6-carboxylic acid |
| SMILES | C=C/C=C(\C=C/C)c1nc2sc3cc(C(=O)O)ccc3n2n1 |
| InChI | InChI=1S/C16H13N3O2S/c1-3-5-10(6-4-2)14-17-16-19(18-14)12-8-7-11(15(20)21)9-13(12)22-16/h3-9H,1H2,2H3,(H,20,21)/b6-4-,10-5+ |
| InChIKey | MMXDUBJEEAPEQC-KNVSICBPSA-N |
| XLogP | 3.79 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|