C13H16F3NO — CID 170718755
2,2,2-trifluoro-1-[(2S,4R)-2-phenylpiperidin-4-yl]ethanol (PubChem CID 170718755) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(2S,4R)-2-phenylpiperidin-4-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[(2S,4R)-2-phenylpiperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 170718755 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2,2,2-trifluoro-1-[(2S,4R)-2-phenylpiperidin-4-yl]ethanol |
| SMILES | OC([C@@H]1CCN[C@H](c2ccccc2)C1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c14-13(15,16)12(18)10-6-7-17-11(8-10)9-4-2-1-3-5-9/h1-5,10-12,17-18H,6-8H2/t10-,11+,12?/m1/s1 |
| InChIKey | DYFWJICWHLAEGL-UBNQGINQSA-N |
| XLogP | 2.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |