C17H24O6 — CID 170720120
dimethyl (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioate (PubChem CID 170720120) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is dimethyl (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioate.
| Compound Name | dimethyl (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioate |
|---|---|
| PubChem CID | 170720120 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | dimethyl (2S)-2-[(3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]butanedioate |
| SMILES | CCC[C@]12CCCC=C1C([C@H](CC(=O)OC)C(=O)OC)OC2=O |
| InChI | InChI=1S/C17H24O6/c1-4-8-17-9-6-5-7-12(17)14(23-16(17)20)11(15(19)22-3)10-13(18)21-2/h7,11,14H,4-6,8-10H2,1-3H3/t11-,14?,17-/m0/s1 |
| InChIKey | GUPPOUAGPLFBNT-ZHGNSCJRSA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|