C21H34O4 — CID 170720125
2-ethylhexyl 2-[(1R,3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate (PubChem CID 170720125) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-ethylhexyl 2-[(1R,3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate.
| Compound Name | 2-ethylhexyl 2-[(1R,3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate |
|---|---|
| PubChem CID | 170720125 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 2-ethylhexyl 2-[(1R,3aS)-3-oxo-3a-propyl-1,4,5,6-tetrahydro-2-benzofuran-1-yl]acetate |
| SMILES | CCCCC(CC)COC(=O)C[C@H]1OC(=O)[C@@]2(CCC)CCCC=C12 |
| InChI | InChI=1S/C21H34O4/c1-4-7-10-16(6-3)15-24-19(22)14-18-17-11-8-9-13-21(17,12-5-2)20(23)25-18/h11,16,18H,4-10,12-15H2,1-3H3/t16?,18-,21+/m1/s1 |
| InChIKey | ITESKTKSBKFEIT-OHIWNTBFSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|