C14H26NO2+ — CID 170720843
[2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidin-1-yl]oxidanium (PubChem CID 170720843) has the molecular formula C14H26NO2+ and a molecular weight of 240.37 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidin-1-yl]oxidanium.
| Compound Name | [2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 170720843 |
| Molecular Formula | C14H26NO2+ |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidin-1-yl]oxidanium |
| SMILES | C=C(C)C(=C)OC1CC(C)(C)N([OH2+])C(C)(C)C1 |
| InChI | InChI=1S/C14H25NO2/c1-10(2)11(3)17-12-8-13(4,5)15(16)14(6,7)9-12/h12,16H,1,3,8-9H2,2,4-7H3/p+1 |
| InChIKey | OBBXBEJBAPWZCS-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 35.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|