C14H25NO2 — CID 170720844
1-hydroxy-2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidine (PubChem CID 170720844) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidine.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidine |
|---|---|
| PubChem CID | 170720844 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethyl-4-(3-methylbuta-1,3-dien-2-yloxy)piperidine |
| SMILES | C=C(C)C(=C)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C14H25NO2/c1-10(2)11(3)17-12-8-13(4,5)15(16)14(6,7)9-12/h12,16H,1,3,8-9H2,2,4-7H3 |
| InChIKey | OBBXBEJBAPWZCS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|