About 3-methoxycyclohexa-1,4-diene-1-carboxylic acid
3-methoxycyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 170720951) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 3-methoxycyclohexa-1,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-methoxycyclohexa-1,4-diene-1-carboxylic acid |
| PubChem CID | 170720951 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3-methoxycyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | COC1C=CCC(C(=O)O)=C1 |
| InChI | InChI=1S/C8H10O3/c1-11-7-4-2-3-6(5-7)8(9)10/h2,4-5,7H,3H2,1H3,(H,9,10) |
| InChIKey | ANCSVKVGBJARFA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxycyclohexa-1,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxycyclohexa-1,4-diene-1-carboxylic acid?
The IUPAC name of 3-methoxycyclohexa-1,4-diene-1-carboxylic acid (CID 170720951) is 3-methoxycyclohexa-1,4-diene-1-carboxylic acid.
What is the SMILES notation for 3-methoxycyclohexa-1,4-diene-1-carboxylic acid?
The canonical SMILES for 3-methoxycyclohexa-1,4-diene-1-carboxylic acid is COC1C=CCC(C(=O)O)=C1.
What is the InChIKey of 3-methoxycyclohexa-1,4-diene-1-carboxylic acid?
The InChIKey is ANCSVKVGBJARFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-11-7-4-2-3-6(5-7)8(9)10/h2,4-5,7H,3H2,1H3,(H,9,10).
What are the key properties of 3-methoxycyclohexa-1,4-diene-1-carboxylic acid?
3-methoxycyclohexa-1,4-diene-1-carboxylic acid has a molecular weight of 154.16 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxycyclohexa-1,4-diene-1-carboxylic acid is sourced from PubChem (CID 170720951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).