C16H13Br — CID 170722188
1-bromo-9,10-bis(ethenyl)tricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene (PubChem CID 170722188) has the molecular formula C16H13Br and a molecular weight of 285.18 g/mol. Its IUPAC name is 1-bromo-9,10-bis(ethenyl)tricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene.
| Compound Name | 1-bromo-9,10-bis(ethenyl)tricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene |
|---|---|
| PubChem CID | 170722188 |
| Molecular Formula | C16H13Br |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 1-bromo-9,10-bis(ethenyl)tricyclo[6.2.2.02,7]dodeca-2,4,6,9,11-pentaene |
| SMILES | C=CC1=C(C=C)C2(Br)C=CC1c1ccccc12 |
| InChI | InChI=1S/C16H13Br/c1-3-11-12-9-10-16(17,14(11)4-2)15-8-6-5-7-13(12)15/h3-10,12H,1-2H2 |
| InChIKey | AGMCZIJVYKIZPD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|