C21H28N4O2 — CID 170723019
N'-(3-methoxypropyl)-N,7-dimethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide (PubChem CID 170723019) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N'-(3-methoxypropyl)-N,7-dimethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide.
| Compound Name | N'-(3-methoxypropyl)-N,7-dimethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide |
|---|---|
| PubChem CID | 170723019 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N'-(3-methoxypropyl)-N,7-dimethyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carbohydrazide |
| SMILES | COCCCNN(C)C(=O)C1C=C2c3cccc4[nH]cc(c34)CC2N(C)C1 |
| InChI | InChI=1S/C21H28N4O2/c1-24-13-15(21(26)25(2)23-8-5-9-27-3)10-17-16-6-4-7-18-20(16)14(12-22-18)11-19(17)24/h4,6-7,10,12,15,19,22-23H,5,8-9,11,13H2,1-3H3 |
| InChIKey | NTISKRBRQHTABI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|