About benzyl chloromethyl heptyl phosphite
benzyl chloromethyl heptyl phosphite (PubChem CID 170723146) has the molecular formula C15H24ClO3P
and a molecular weight of 318.78 g/mol. Its IUPAC name is benzyl chloromethyl heptyl phosphite.
Molecular Properties
| Compound Name | benzyl chloromethyl heptyl phosphite |
| PubChem CID | 170723146 |
| Molecular Formula | C15H24ClO3P |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | benzyl chloromethyl heptyl phosphite |
| SMILES | CCCCCCCOP(OCCl)OCc1ccccc1 |
| InChI | InChI=1S/C15H24ClO3P/c1-2-3-4-5-9-12-17-20(19-14-16)18-13-15-10-7-6-8-11-15/h6-8,10-11H,2-5,9,12-14H2,1H3 |
| InChIKey | ORFXRVFNOYQEPN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl chloromethyl heptyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl chloromethyl heptyl phosphite?
The IUPAC name of benzyl chloromethyl heptyl phosphite (CID 170723146) is benzyl chloromethyl heptyl phosphite.
What is the SMILES notation for benzyl chloromethyl heptyl phosphite?
The canonical SMILES for benzyl chloromethyl heptyl phosphite is CCCCCCCOP(OCCl)OCc1ccccc1.
What is the InChIKey of benzyl chloromethyl heptyl phosphite?
The InChIKey is ORFXRVFNOYQEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24ClO3P/c1-2-3-4-5-9-12-17-20(19-14-16)18-13-15-10-7-6-8-11-15/h6-8,10-11H,2-5,9,12-14H2,1H3.
What are the key properties of benzyl chloromethyl heptyl phosphite?
benzyl chloromethyl heptyl phosphite has a molecular weight of 318.78 g/mol, XLogP of 5.63, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl chloromethyl heptyl phosphite is sourced from PubChem (CID 170723146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).