About ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione
ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 170724271) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione |
| PubChem CID | 170724271 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CC.CC(C)C1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C8H13NO2.C2H6/c1-5(2)6-4-7(10)9(3)8(6)11;1-2/h5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | KHJUPHOKSKPPDX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione?
The IUPAC name of ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione (CID 170724271) is ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione.
What is the SMILES notation for ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione?
The canonical SMILES for ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione is CC.CC(C)C1CC(=O)N(C)C1=O.
What is the InChIKey of ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione?
The InChIKey is KHJUPHOKSKPPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.C2H6/c1-5(2)6-4-7(10)9(3)8(6)11;1-2/h5-6H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione?
ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione has a molecular weight of 185.27 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3-propan-2-ylpyrrolidine-2,5-dione is sourced from PubChem (CID 170724271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).