C19H34N2O — CID 170724335
ethane;N-[(Z)-2-ethyliminopent-3-enyl]cyclohepta-1,3,6-triene-1-carboxamide;molecular hydrogen (PubChem CID 170724335) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is ethane;N-[(Z)-2-ethyliminopent-3-enyl]cyclohepta-1,3,6-triene-1-carboxamide;molecular hydrogen.
| Compound Name | ethane;N-[(Z)-2-ethyliminopent-3-enyl]cyclohepta-1,3,6-triene-1-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 170724335 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | ethane;N-[(Z)-2-ethyliminopent-3-enyl]cyclohepta-1,3,6-triene-1-carboxamide;molecular hydrogen |
| SMILES | C/C=C\C(CNC(=O)C1=CC=CCC=C1)=N/CC.CC.CC.[H][H] |
| InChI | InChI=1S/C15H20N2O.2C2H6.H2/c1-3-9-14(16-4-2)12-17-15(18)13-10-7-5-6-8-11-13;2*1-2;/h3,5,7-11H,4,6,12H2,1-2H3,(H,17,18);2*1-2H3;1H/b9-3-,16-14+;;; |
| InChIKey | DHBLIZQZKNUBHC-PMOXPELESA-N |
| XLogP | 4.88 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|