C30H32N8O6 — CID 17072444
1,3-dimethyl-8-[4-[1-(2-methyl-4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-7-[(4-methylphenyl)methyl]purine-2,6-dione (PubChem CID 17072444) has the molecular formula C30H32N8O6 and a molecular weight of 600.64 g/mol. Its IUPAC name is 1,3-dimethyl-8-[4-[1-(2-methyl-4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-7-[(4-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[4-[1-(2-methyl-4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-7-[(4-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 17072444 |
| Molecular Formula | C30H32N8O6 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 1,3-dimethyl-8-[4-[1-(2-methyl-4-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-1-yl]-7-[(4-methylphenyl)methyl]purine-2,6-dione |
| SMILES | Cc1ccc(Cn2c(N3CCN(C4CC(=O)N(c5ccc([N+](=O)[O-])cc5C)C4=O)CC3)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C30H32N8O6/c1-18-5-7-20(8-6-18)17-36-25-26(32(3)30(42)33(4)28(25)41)31-29(36)35-13-11-34(12-14-35)23-16-24(39)37(27(23)40)22-10-9-21(38(43)44)15-19(22)2/h5-10,15,23H,11-14,16-17H2,1-4H3 |
| InChIKey | JSPKRONXKYXSSE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 148.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|