C25H25N3O2 — CID 170725223
3-(aminomethyl)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 170725223) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-(aminomethyl)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 170725223 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-(aminomethyl)-N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | NCC12CC(C(=O)NCCC(=O)N3Cc4ccccc4C#Cc4ccccc43)(C1)C2 |
| InChI | InChI=1S/C25H25N3O2/c26-17-24-14-25(15-24,16-24)23(30)27-12-11-22(29)28-13-20-7-2-1-5-18(20)9-10-19-6-3-4-8-21(19)28/h1-8H,11-17,26H2,(H,27,30) |
| InChIKey | DTRHSSDDFKTQFV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|