C14H14ClFN4O2S — CID 170726346
(6R,7R)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-6-ol (PubChem CID 170726346) has the molecular formula C14H14ClFN4O2S and a molecular weight of 356.81 g/mol. Its IUPAC name is (6R,7R)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-6-ol.
| Compound Name | (6R,7R)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-6-ol |
|---|---|
| PubChem CID | 170726346 |
| Molecular Formula | C14H14ClFN4O2S |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (6R,7R)-12-chloro-13-fluoro-16-methylsulfanyl-9-oxa-2,11,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18),15-pentaen-6-ol |
| SMILES | CSc1nc2c3c(nc(Cl)c(F)c3n1)OC[C@@H]1[C@H](O)CCCN21 |
| InChI | InChI=1S/C14H14ClFN4O2S/c1-23-14-17-10-8-12(19-14)20-4-2-3-7(21)6(20)5-22-13(8)18-11(15)9(10)16/h6-7,21H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | WYJXGNCDSOCIJK-RNFRBKRXSA-N |
| XLogP | 2.26 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|