C13H12ClF3N4OS — CID 170726349
(12S)-7-chloro-13-(2,2-difluoroethyl)-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726349) has the molecular formula C13H12ClF3N4OS and a molecular weight of 364.78 g/mol. Its IUPAC name is (12S)-7-chloro-13-(2,2-difluoroethyl)-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | (12S)-7-chloro-13-(2,2-difluoroethyl)-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726349 |
| Molecular Formula | C13H12ClF3N4OS |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | (12S)-7-chloro-13-(2,2-difluoroethyl)-6-fluoro-12-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CSc1nc2c3c(nc(Cl)c(F)c3n1)OC[C@H](C)N2CC(F)F |
| InChI | InChI=1S/C13H12ClF3N4OS/c1-5-4-22-12-7-9(8(17)10(14)19-12)18-13(23-2)20-11(7)21(5)3-6(15)16/h5-6H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | ZOGABXVHFMMSHZ-YFKPBYRVSA-N |
| XLogP | 3.39 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|