C13H14ClFN4OS — CID 170726355
(12S)-7-chloro-12-ethyl-6-fluoro-13-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726355) has the molecular formula C13H14ClFN4OS and a molecular weight of 328.80 g/mol. Its IUPAC name is (12S)-7-chloro-12-ethyl-6-fluoro-13-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | (12S)-7-chloro-12-ethyl-6-fluoro-13-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726355 |
| Molecular Formula | C13H14ClFN4OS |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | (12S)-7-chloro-12-ethyl-6-fluoro-13-methyl-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | CC[C@H]1COc2nc(Cl)c(F)c3nc(SC)nc(c23)N1C |
| InChI | InChI=1S/C13H14ClFN4OS/c1-4-6-5-20-12-7-9(8(15)10(14)17-12)16-13(21-3)18-11(7)19(6)2/h6H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | VWGDLOYJZUCNJG-LURJTMIESA-N |
| XLogP | 3.15 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|