C19H19FN4O — CID 170726453
(12S)-13-benzyl-6-fluoro-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene (PubChem CID 170726453) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is (12S)-13-benzyl-6-fluoro-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene.
| Compound Name | (12S)-13-benzyl-6-fluoro-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
|---|---|
| PubChem CID | 170726453 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (12S)-13-benzyl-6-fluoro-3,7,12-trimethyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaene |
| SMILES | Cc1nc2c3c(nc(C)c(F)c3n1)OC[C@H](C)N2Cc1ccccc1 |
| InChI | InChI=1S/C19H19FN4O/c1-11-10-25-19-15-17(16(20)12(2)21-19)22-13(3)23-18(15)24(11)9-14-7-5-4-6-8-14/h4-8,11H,9-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | YYYKYBKJWLHDRM-NSHDSACASA-N |
| XLogP | 3.57 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |