C27H23F3N4O3 — CID 170726737
4-[13-ethyl-6-fluoro-3-(4-fluorobutoxy)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 170726737) has the molecular formula C27H23F3N4O3 and a molecular weight of 508.50 g/mol. Its IUPAC name is 4-[13-ethyl-6-fluoro-3-(4-fluorobutoxy)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[13-ethyl-6-fluoro-3-(4-fluorobutoxy)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 170726737 |
| Molecular Formula | C27H23F3N4O3 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 4-[13-ethyl-6-fluoro-3-(4-fluorobutoxy)-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3nc4c5c(nc(OCCCCF)nc5c3F)N(CC)CCO4)c12 |
| InChI | InChI=1S/C27H23F3N4O3/c1-3-17-19(29)8-7-15-13-16(35)14-18(20(15)17)23-22(30)24-21-25(33-27(32-24)37-11-6-5-9-28)34(4-2)10-12-36-26(21)31-23/h1,7-8,13-14,35H,4-6,9-12H2,2H3 |
| InChIKey | TUWPYPYLLYIXAL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|