C11H12N4 — CID 170726880
3,11-dimethyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene (PubChem CID 170726880) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3,11-dimethyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene.
| Compound Name | 3,11-dimethyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene |
|---|---|
| PubChem CID | 170726880 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3,11-dimethyl-2,4,6,10-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,9,11-pentaene |
| SMILES | Cc1cc2nc(C)nc3c2c(n1)CCN3 |
| InChI | InChI=1S/C11H12N4/c1-6-5-9-10-8(13-6)3-4-12-11(10)15-7(2)14-9/h5H,3-4H2,1-2H3,(H,12,14,15) |
| InChIKey | JJLSDUCDZLGYKR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |