C11H19FN+ — CID 170727008
(6Z)-8-ethyl-6-(fluoromethylidene)-4-methyl-2,3,5,7-tetrahydro-1H-pyrrolizin-4-ium (PubChem CID 170727008) has the molecular formula C11H19FN+ and a molecular weight of 184.28 g/mol. Its IUPAC name is (6Z)-8-ethyl-6-(fluoromethylidene)-4-methyl-2,3,5,7-tetrahydro-1H-pyrrolizin-4-ium.
| Compound Name | (6Z)-8-ethyl-6-(fluoromethylidene)-4-methyl-2,3,5,7-tetrahydro-1H-pyrrolizin-4-ium |
|---|---|
| PubChem CID | 170727008 |
| Molecular Formula | C11H19FN+ |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (6Z)-8-ethyl-6-(fluoromethylidene)-4-methyl-2,3,5,7-tetrahydro-1H-pyrrolizin-4-ium |
| SMILES | CCC12CCC[N+]1(C)C/C(=C\F)C2 |
| InChI | InChI=1S/C11H19FN/c1-3-11-5-4-6-13(11,2)9-10(7-11)8-12/h8H,3-7,9H2,1-2H3/q+1/b10-8- |
| InChIKey | BIRXQTSYEQFGDX-NTMALXAHSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|