C27H30F3N5O2 — CID 170727176
8-[5-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]-1-oxa-8-azaspiro[4.5]decane-3-carbaldehyde (PubChem CID 170727176) has the molecular formula C27H30F3N5O2 and a molecular weight of 513.56 g/mol. Its IUPAC name is 8-[5-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]-1-oxa-8-azaspiro[4.5]decane-3-carbaldehyde.
| Compound Name | 8-[5-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]-1-oxa-8-azaspiro[4.5]decane-3-carbaldehyde |
|---|---|
| PubChem CID | 170727176 |
| Molecular Formula | C27H30F3N5O2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 8-[5-[(6R,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-2-pyridinyl]-1-oxa-8-azaspiro[4.5]decane-3-carbaldehyde |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@H](c2ccc(N3CCC4(CC3)CC(C=O)CO4)nc2)N1CC(F)(F)F |
| InChI | InChI=1S/C27H30F3N5O2/c1-17-10-21-20(3-4-23-22(21)13-32-33-23)25(35(17)16-27(28,29)30)19-2-5-24(31-12-19)34-8-6-26(7-9-34)11-18(14-36)15-37-26/h2-5,12-14,17-18,25H,6-11,15-16H2,1H3,(H,32,33)/t17-,18?,25+/m1/s1 |
| InChIKey | WQJHAIMDBHENBQ-ZTXIOURESA-N |
| XLogP | 4.43 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|