C13H22F2N2 — CID 170727886
(3R,4E)-3-N-(2,2-difluoroethyl)-4-ethenyl-3-N-propan-2-ylhexa-1,4-diene-2,3-diamine (PubChem CID 170727886) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3R,4E)-3-N-(2,2-difluoroethyl)-4-ethenyl-3-N-propan-2-ylhexa-1,4-diene-2,3-diamine.
| Compound Name | (3R,4E)-3-N-(2,2-difluoroethyl)-4-ethenyl-3-N-propan-2-ylhexa-1,4-diene-2,3-diamine |
|---|---|
| PubChem CID | 170727886 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3R,4E)-3-N-(2,2-difluoroethyl)-4-ethenyl-3-N-propan-2-ylhexa-1,4-diene-2,3-diamine |
| SMILES | C=C/C(=C\C)[C@H](C(=C)N)N(CC(F)F)C(C)C |
| InChI | InChI=1S/C13H22F2N2/c1-6-11(7-2)13(10(5)16)17(9(3)4)8-12(14)15/h6-7,9,12-13H,1,5,8,16H2,2-4H3/b11-7+/t13-/m0/s1 |
| InChIKey | LPFZNMYJNYXMGD-HJTPGIPUSA-N |
| XLogP | 2.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|