C14H16FN3O3 — CID 170728005
6-fluoro-2,3-dihydro-1H-isoindole-5-carboxamide;piperidine-2,6-dione (PubChem CID 170728005) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1H-isoindole-5-carboxamide;piperidine-2,6-dione.
| Compound Name | 6-fluoro-2,3-dihydro-1H-isoindole-5-carboxamide;piperidine-2,6-dione |
|---|---|
| PubChem CID | 170728005 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 6-fluoro-2,3-dihydro-1H-isoindole-5-carboxamide;piperidine-2,6-dione |
| SMILES | NC(=O)c1cc2c(cc1F)CNC2.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C9H9FN2O.C5H7NO2/c10-8-2-6-4-12-3-5(6)1-7(8)9(11)13;7-4-2-1-3-5(8)6-4/h1-2,12H,3-4H2,(H2,11,13);1-3H2,(H,6,7,8) |
| InChIKey | KBIZWJNEKXAGDV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|