About 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine
1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine (PubChem CID 170728069) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 170728069 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine |
| SMILES | C=C/C=C(\C=C)CN1CC=C(CCOC)CC1 |
| InChI | InChI=1S/C15H23NO/c1-4-6-14(5-2)13-16-10-7-15(8-11-16)9-12-17-3/h4-7H,1-2,8-13H2,3H3/b14-6+ |
| InChIKey | BEBFQGJALCYGDO-MKMNVTDBSA-N |
| XLogP | 2.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine (CID 170728069) is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine is C=C/C=C(\C=C)CN1CC=C(CCOC)CC1.
What is the InChIKey of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine?
The InChIKey is BEBFQGJALCYGDO-MKMNVTDBSA-N. The full InChI is InChI=1S/C15H23NO/c1-4-6-14(5-2)13-16-10-7-15(8-11-16)9-12-17-3/h4-7H,1-2,8-13H2,3H3/b14-6+.
What are the key properties of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine?
1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine has a molecular weight of 233.35 g/mol, XLogP of 2.95, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-2-ethenylpenta-2,4-dienyl]-4-(2-methoxyethyl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 170728069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).