C33H48F3N3 — CID 170728303
(8R)-6-[(4E,6Z)-7-ethenyl-10-ethyl-10-propyltrideca-4,6-dien-4-yl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline (PubChem CID 170728303) has the molecular formula C33H48F3N3 and a molecular weight of 543.76 g/mol. Its IUPAC name is (8R)-6-[(4E,6Z)-7-ethenyl-10-ethyl-10-propyltrideca-4,6-dien-4-yl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline.
| Compound Name | (8R)-6-[(4E,6Z)-7-ethenyl-10-ethyl-10-propyltrideca-4,6-dien-4-yl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 170728303 |
| Molecular Formula | C33H48F3N3 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.38 |
| IUPAC Name | (8R)-6-[(4E,6Z)-7-ethenyl-10-ethyl-10-propyltrideca-4,6-dien-4-yl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
| SMILES | C=C/C(=C\C=C(/CCC)C1c2ccc3[nH]ncc3c2C[C@@H](C)N1CC(F)(F)F)CCC(CC)(CCC)CCC |
| InChI | InChI=1S/C33H48F3N3/c1-7-12-26(14-13-25(10-4)17-20-32(11-5,18-8-2)19-9-3)31-27-15-16-30-29(22-37-38-30)28(27)21-24(6)39(31)23-33(34,35)36/h10,13-16,22,24,31H,4,7-9,11-12,17-21,23H2,1-3,5-6H3,(H,37,38)/b25-13+,26-14+/t24-,31?/m1/s1 |
| InChIKey | QVOMIRACDJLBRT-ZGICJDNYSA-N |
| XLogP | 10.03 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|