C18H20 — CID 170728886
(1S,2S)-1,6-dimethyl-2-phenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 170728886) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is (1S,2S)-1,6-dimethyl-2-phenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,2S)-1,6-dimethyl-2-phenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 170728886 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1S,2S)-1,6-dimethyl-2-phenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc2c(c1)CC[C@H](c1ccccc1)[C@@H]2C |
| InChI | InChI=1S/C18H20/c1-13-8-10-18-14(2)17(11-9-16(18)12-13)15-6-4-3-5-7-15/h3-8,10,12,14,17H,9,11H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | IDIZEXFVPGBQKG-YOEHRIQHSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |