C40H59N3O4 — CID 170730110
N'-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(1R)-2-(2-aminoethyl)cyclohexyl]-N,N'-dimethyloxamide (PubChem CID 170730110) has the molecular formula C40H59N3O4 and a molecular weight of 645.93 g/mol. Its IUPAC name is N'-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(1R)-2-(2-aminoethyl)cyclohexyl]-N,N'-dimethyloxamide.
| Compound Name | N'-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(1R)-2-(2-aminoethyl)cyclohexyl]-N,N'-dimethyloxamide |
|---|---|
| PubChem CID | 170730110 |
| Molecular Formula | C40H59N3O4 |
| Molecular Weight | 645.93 g/mol |
| Exact Mass | 645.45 |
| IUPAC Name | N'-[(14aS)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicen-2-yl]-N-[(1R)-2-(2-aminoethyl)cyclohexyl]-N,N'-dimethyloxamide |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC=C1C2(C)CC[C@@]2(C)C3CC(C)(N(C)C(=O)C(=O)N(C)[C@@H]4CCCCC4CCN)CCC3(C)CCC12C |
| InChI | InChI=1S/C40H59N3O4/c1-25-27-13-14-31-38(4,28(27)23-30(44)33(25)45)19-21-40(6)32-24-37(3,18-16-36(32,2)17-20-39(31,40)5)43(8)35(47)34(46)42(7)29-12-10-9-11-26(29)15-22-41/h13-14,23,26,29,32,45H,9-12,15-22,24,41H2,1-8H3/t26?,29-,32?,36?,37?,38?,39?,40+/m1/s1 |
| InChIKey | KVTVIHGLUDLUCT-FAGFORFNSA-N |
| XLogP | 7.19 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.93 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|