About 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine
2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine (PubChem CID 170730315) has the molecular formula C9H16BrN3
and a molecular weight of 246.15 g/mol. Its IUPAC name is 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine |
| PubChem CID | 170730315 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine |
| SMILES | CN(C)C(C)(C)c1cc(Br)nn1C |
| InChI | InChI=1S/C9H16BrN3/c1-9(2,12(3)4)7-6-8(10)11-13(7)5/h6H,1-5H3 |
| InChIKey | ZVQVSNRMQOSQRE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine?
The IUPAC name of 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine (CID 170730315) is 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine?
The canonical SMILES for 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine is CN(C)C(C)(C)c1cc(Br)nn1C.
What is the InChIKey of 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine?
The InChIKey is ZVQVSNRMQOSQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrN3/c1-9(2,12(3)4)7-6-8(10)11-13(7)5/h6H,1-5H3.
What are the key properties of 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine?
2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine has a molecular weight of 246.15 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-1-methylpyrazol-5-yl)-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 170730315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).