C12H14BrF3N2O3 — CID 170730662
tert-butyl N-[2-bromo-5-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamate (PubChem CID 170730662) has the molecular formula C12H14BrF3N2O3 and a molecular weight of 371.15 g/mol. Its IUPAC name is tert-butyl N-[2-bromo-5-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-bromo-5-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 170730662 |
| Molecular Formula | C12H14BrF3N2O3 |
| Molecular Weight | 371.15 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | tert-butyl N-[2-bromo-5-(2,2,2-trifluoroethoxy)-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Br)ncc1OCC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O3/c1-11(2,3)21-10(19)18-7-4-9(13)17-5-8(7)20-6-12(14,15)16/h4-5H,6H2,1-3H3,(H,17,18,19) |
| InChIKey | JWLIGXVEOFSHBA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|