C9H16N2O — CID 170730716
2-N-ethenyl-1-N-methyl-3-propan-2-yloxypropane-1,2-diimine (PubChem CID 170730716) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-N-ethenyl-1-N-methyl-3-propan-2-yloxypropane-1,2-diimine.
| Compound Name | 2-N-ethenyl-1-N-methyl-3-propan-2-yloxypropane-1,2-diimine |
|---|---|
| PubChem CID | 170730716 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-N-ethenyl-1-N-methyl-3-propan-2-yloxypropane-1,2-diimine |
| SMILES | C=C/N=C(/C=N/C)COC(C)C |
| InChI | InChI=1S/C9H16N2O/c1-5-11-9(6-10-4)7-12-8(2)3/h5-6,8H,1,7H2,2-4H3/b10-6+,11-9- |
| InChIKey | BPUCKEGYUHDYTE-QCOLZXCRSA-N |
| XLogP | 1.70 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|