C19H21F2N7O — CID 170730763
N-[4-[[2-(1,1-difluoroethyl)-2-methyl-1H-pyrimidin-6-yl]amino]-5-(1-methyl-2H-pyrazin-1-ium-2-id-5-yl)-2-pyridinyl]acetamide (PubChem CID 170730763) has the molecular formula C19H21F2N7O and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[4-[[2-(1,1-difluoroethyl)-2-methyl-1H-pyrimidin-6-yl]amino]-5-(1-methyl-2H-pyrazin-1-ium-2-id-5-yl)-2-pyridinyl]acetamide.
| Compound Name | N-[4-[[2-(1,1-difluoroethyl)-2-methyl-1H-pyrimidin-6-yl]amino]-5-(1-methyl-2H-pyrazin-1-ium-2-id-5-yl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 170730763 |
| Molecular Formula | C19H21F2N7O |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[4-[[2-(1,1-difluoroethyl)-2-methyl-1H-pyrimidin-6-yl]amino]-5-(1-methyl-2H-pyrazin-1-ium-2-id-5-yl)-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC2=CC=NC(C)(C(C)(F)F)N2)c(-c2c[n+](C)[c-]cn2)cn1 |
| InChI | InChI=1S/C19H21F2N7O/c1-12(29)25-17-9-14(13(10-23-17)15-11-28(4)8-7-22-15)26-16-5-6-24-19(3,27-16)18(2,20)21/h5-7,9-11,27H,1-4H3,(H2,23,25,26,29) |
| InChIKey | JGZSXBVEQSAITH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|