About N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide
N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide (PubChem CID 170730816) has the molecular formula C14H15F2N5O2
and a molecular weight of 323.30 g/mol. Its IUPAC name is N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide |
| PubChem CID | 170730816 |
| Molecular Formula | C14H15F2N5O2 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(Nc2cc(C)nc(C(C)(F)F)n2)c(O)cn1 |
| InChI | InChI=1S/C14H15F2N5O2/c1-7-4-12(21-13(18-7)14(3,15)16)20-9-5-11(19-8(2)22)17-6-10(9)23/h4-6,23H,1-3H3,(H2,17,18,19,20,21,22) |
| InChIKey | BQBDSDWSAMFXOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide?
The IUPAC name of N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide (CID 170730816) is N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide.
What is the SMILES notation for N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide?
The canonical SMILES for N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide is CC(=O)Nc1cc(Nc2cc(C)nc(C(C)(F)F)n2)c(O)cn1.
What is the InChIKey of N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide?
The InChIKey is BQBDSDWSAMFXOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2N5O2/c1-7-4-12(21-13(18-7)14(3,15)16)20-9-5-11(19-8(2)22)17-6-10(9)23/h4-6,23H,1-3H3,(H2,17,18,19,20,21,22).
What are the key properties of N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide?
N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide has a molecular weight of 323.30 g/mol, XLogP of 2.70, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[2-(1,1-difluoroethyl)-6-methylpyrimidin-4-yl]amino]-5-hydroxy-2-pyridinyl]acetamide is sourced from PubChem (CID 170730816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).