C19H21B3F2N6O4 — CID 170730856
CID 170730856 (PubChem CID 170730856) has the molecular formula C19H21B3F2N6O4 and a molecular weight of 467.85 g/mol.
| Compound Name | CID 170730856 |
|---|---|
| PubChem CID | 170730856 |
| Molecular Formula | C19H21B3F2N6O4 |
| Molecular Weight | 467.85 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C([B])(O)Oc1cnc(NC(C)=O)cc1Nc1cc(NC2CCC2)nc(C(C)(F)F)n1 |
| InChI | InChI=1S/C19H21B3F2N6O4/c1-9(31)26-13-6-11(12(8-25-13)34-19(22,33)18(20,21)32)28-15-7-14(27-10-4-3-5-10)29-16(30-15)17(2,23)24/h6-8,10,32-33H,3-5H2,1-2H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | FUVUCEMRJKAZPL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.85 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|