C14H18F2N2O3S — CID 170731351
(3aS,6aS)-2-[4-(difluoromethoxy)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 170731351) has the molecular formula C14H18F2N2O3S and a molecular weight of 332.37 g/mol. Its IUPAC name is (3aS,6aS)-2-[4-(difluoromethoxy)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aS,6aS)-2-[4-(difluoromethoxy)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 170731351 |
| Molecular Formula | C14H18F2N2O3S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (3aS,6aS)-2-[4-(difluoromethoxy)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | NC1C[C@@H]2CN(S(=O)(=O)c3ccc(OC(F)F)cc3)C[C@H]2C1 |
| InChI | InChI=1S/C14H18F2N2O3S/c15-14(16)21-12-1-3-13(4-2-12)22(19,20)18-7-9-5-11(17)6-10(9)8-18/h1-4,9-11,14H,5-8,17H2/t9-,10-/m1/s1 |
| InChIKey | KBIRUISTUSWWQS-NXEZZACHSA-N |
| XLogP | 1.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |