C19H30N4O3S — CID 170731414
(3S,3aS,5S,6aS)-3-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2-(oxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 170731414) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is (3S,3aS,5S,6aS)-3-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2-(oxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3S,3aS,5S,6aS)-3-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2-(oxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 170731414 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3S,3aS,5S,6aS)-3-(3-cyclopropyl-1-methylpyrazol-5-yl)sulfonyl-2-(oxan-4-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cn1nc(C2CC2)cc1S(=O)(=O)[C@H]1[C@H]2C[C@@H](N)C[C@@H]2CN1C1CCOCC1 |
| InChI | InChI=1S/C19H30N4O3S/c1-22-18(10-17(21-22)12-2-3-12)27(24,25)19-16-9-14(20)8-13(16)11-23(19)15-4-6-26-7-5-15/h10,12-16,19H,2-9,11,20H2,1H3/t13-,14+,16+,19+/m1/s1 |
| InChIKey | CHNZCMCWLBVEPL-DFHZNHDVSA-N |
| XLogP | 1.25 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |