C17H24ClN3O4S — CID 170731437
(3aR,6aS)-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfonyl]-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 170731437) has the molecular formula C17H24ClN3O4S and a molecular weight of 401.92 g/mol. Its IUPAC name is (3aR,6aS)-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfonyl]-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfonyl]-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 170731437 |
| Molecular Formula | C17H24ClN3O4S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (3aR,6aS)-5-[(5-chloro-2-methoxy-3-pyridinyl)sulfonyl]-2-(oxan-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | COc1ncc(Cl)cc1S(=O)(=O)N1C[C@H]2CN(C3CCOCC3)C[C@H]2C1 |
| InChI | InChI=1S/C17H24ClN3O4S/c1-24-17-16(6-14(18)7-19-17)26(22,23)21-10-12-8-20(9-13(12)11-21)15-2-4-25-5-3-15/h6-7,12-13,15H,2-5,8-11H2,1H3/t12-,13+ |
| InChIKey | JBBHWSDZBTZMGI-BETUJISGSA-N |
| XLogP | 1.47 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |