C18H23F3N4O3S — CID 170731528
(3aR,6aR)-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2-(2-oxaspiro[3.3]heptan-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 170731528) has the molecular formula C18H23F3N4O3S and a molecular weight of 432.47 g/mol. Its IUPAC name is (3aR,6aR)-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2-(2-oxaspiro[3.3]heptan-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2-(2-oxaspiro[3.3]heptan-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 170731528 |
| Molecular Formula | C18H23F3N4O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (3aR,6aR)-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2-(2-oxaspiro[3.3]heptan-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1nc(C(F)(F)F)ncc1S(=O)(=O)N1C[C@H]2CN(C3CC4(COC4)C3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H23F3N4O3S/c1-11-15(4-22-16(23-11)18(19,20)21)29(26,27)25-7-12-5-24(6-13(12)8-25)14-2-17(3-14)9-28-10-17/h4,12-14H,2-3,5-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | HXGSUQGMVZLFAI-CHWSQXEVSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |