C18H33N3O — CID 170732100
(3Z,5E)-4-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methylocta-1,3,5-trien-3-ol (PubChem CID 170732100) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is (3Z,5E)-4-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methylocta-1,3,5-trien-3-ol.
| Compound Name | (3Z,5E)-4-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methylocta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 170732100 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | (3Z,5E)-4-[(4,7-dimethyl-1,4,7-triazonan-1-yl)methyl]-6-methylocta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(\C=C(/C)CC)CN1CCN(C)CCN(C)CC1 |
| InChI | InChI=1S/C18H33N3O/c1-6-16(3)14-17(18(22)7-2)15-21-12-10-19(4)8-9-20(5)11-13-21/h7,14,22H,2,6,8-13,15H2,1,3-5H3/b16-14+,18-17- |
| InChIKey | IRZCUUFWZMIAHC-YDNIAVERSA-N |
| XLogP | 2.52 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|