C12H29N3O — CID 170732304
N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one (PubChem CID 170732304) has the molecular formula C12H29N3O and a molecular weight of 231.38 g/mol. Its IUPAC name is N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one.
| Compound Name | N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 170732304 |
| Molecular Formula | C12H29N3O |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.23 |
| IUPAC Name | N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one |
| SMILES | CC.CCN(CC)CN.CN1CCCC1=O |
| InChI | InChI=1S/C5H14N2.C5H9NO.C2H6/c1-3-7(4-2)5-6;1-6-4-2-3-5(6)7;1-2/h3-6H2,1-2H3;2-4H2,1H3;1-2H3 |
| InChIKey | PODCVURJHSRXRP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|