About N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one
N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one (PubChem CID 170732304) has the molecular formula C12H29N3O
and a molecular weight of 231.38 g/mol. Its IUPAC name is N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one |
| PubChem CID | 170732304 |
| Molecular Formula | C12H29N3O |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.23 |
| IUPAC Name | N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one |
| SMILES | CC.CCN(CC)CN.CN1CCCC1=O |
| InChI | InChI=1S/C5H14N2.C5H9NO.C2H6/c1-3-7(4-2)5-6;1-6-4-2-3-5(6)7;1-2/h3-6H2,1-2H3;2-4H2,1H3;1-2H3 |
| InChIKey | PODCVURJHSRXRP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one?
The IUPAC name of N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one (CID 170732304) is N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one.
What is the SMILES notation for N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one?
The canonical SMILES for N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one is CC.CCN(CC)CN.CN1CCCC1=O.
What is the InChIKey of N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one?
The InChIKey is PODCVURJHSRXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2.C5H9NO.C2H6/c1-3-7(4-2)5-6;1-6-4-2-3-5(6)7;1-2/h3-6H2,1-2H3;2-4H2,1H3;1-2H3.
What are the key properties of N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one?
N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one has a molecular weight of 231.38 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethylmethanediamine;ethane;1-methylpyrrolidin-2-one is sourced from PubChem (CID 170732304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).